CAS 352563-21-4 appears in our catalog under these names: Ogremorphin, 98%, Ogremorphin/ 99.65% (existing batch purity), Ogremorphin 98%, Ogremorphin, 98%, 98%, Ogremorphin, 99.60%. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 100 mg.
5-ethyl-5'-naphthalen-1-ylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one (CAS 352563-21-4) is a chemical compound with the molecular formula C21H17N3OS and a molecular weight of 359.4 g/mol. IUPAC name: 5-ethyl-5'-naphthalen-1-ylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one. InChIKey: FXTVKHHEAAQZHM-UHFFFAOYSA-N.
| Molecular formula | C21H17N3OS |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 5-ethyl-5'-naphthalen-1-ylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
| InChIKey | FXTVKHHEAAQZHM-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)NC(=O)C23NN=C(S3)C4=CC=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)