CAS 253168-80-8 is the registry number for Apremilast Impurity 106. Offered by: Chemat Brand. Available pack sizes: on request.
2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-5-nitroisoindole-1,3-dione (CAS 253168-80-8) is a chemical compound with the molecular formula C20H20N2O8S and a molecular weight of 448.4 g/mol. IUPAC name: 2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-5-nitroisoindole-1,3-dione. InChIKey: UGSRNQAWGQMBCT-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O8S |
|---|---|
| Molecular weight | 448.4 g/mol |
| IUPAC name | 2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-5-nitroisoindole-1,3-dione |
| InChIKey | UGSRNQAWGQMBCT-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(CS(=O)(=O)C)N2C(=O)C3=C(C2=O)C=C(C=C3)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)