CAS 253178-46-0 appears in our catalog under these names: Sildenafil Impurity 4 (Isosildenafil), Sildenafil Impurity 169( (Iso Sildenafil)), Iso Sildenafil, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
5-[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-2-methyl-3-propyl-6H-pyrazolo[4,3-d]pyrimidin-7-one (CAS 253178-46-0) is a chemical compound with the molecular formula C22H30N6O4S and a molecular weight of 474.6 g/mol. IUPAC name: 5-[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-2-methyl-3-propyl-6H-pyrazolo[4,3-d]pyrimidin-7-one. InChIKey: AEHJOHLAUWUPQW-UHFFFAOYSA-N.
| Molecular formula | C22H30N6O4S |
|---|---|
| Molecular weight | 474.6 g/mol |
| IUPAC name | 5-[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-2-methyl-3-propyl-6H-pyrazolo[4,3-d]pyrimidin-7-one |
| InChIKey | AEHJOHLAUWUPQW-UHFFFAOYSA-N |
| SMILES | CCCC1=C2C(=NN1C)C(=O)NC(=N2)C3=C(C=CC(=C3)S(=O)(=O)N4CCN(CC4)C)OCC |
Computed by PubChem (NCBI)