CAS 25319-98-6 appears in our catalog under these names: 3,5-Dichloro-4-hydroxybenzenesulfonic Acid, 3,5-Dichloro-4-hydroxybenzenesulfonic acid 95%, 3,5-Dichloro-4-hydroxybenzenesulfonic acid, 95%, 95%, 3,5-DICHLORO-4-HYDROXYBENZENESULFONIC ACID, 95%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g.
3,5-dichloro-4-hydroxybenzenesulfonic acid (CAS 25319-98-6) is a chemical compound with the molecular formula C6H4Cl2O4S and a molecular weight of 243.06 g/mol. IUPAC name: 3,5-dichloro-4-hydroxybenzenesulfonic acid. InChIKey: PGDCAFRJYQICAY-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2O4S |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | 3,5-dichloro-4-hydroxybenzenesulfonic acid |
| InChIKey | PGDCAFRJYQICAY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Cl)S(=O)(=O)O |
Computed by PubChem (NCBI)