Products 25319-98-6

CAS 25319-98-6 appears in our catalog under these names: 3,5-Dichloro-4-hydroxybenzenesulfonic Acid, 3,5-Dichloro-4-hydroxybenzenesulfonic acid 95%, 3,5-Dichloro-4-hydroxybenzenesulfonic acid, 95%, 95%, 3,5-DICHLORO-4-HYDROXYBENZENESULFONIC ACID, 95%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3,5-dichloro-4-hydroxybenzenesulfonic acid (CAS 25319-98-6) is a chemical compound with the molecular formula C6H4Cl2O4S and a molecular weight of 243.06 g/mol. IUPAC name: 3,5-dichloro-4-hydroxybenzenesulfonic acid. InChIKey: PGDCAFRJYQICAY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4Cl2O4S
Molecular weight243.06 g/mol
IUPAC name3,5-dichloro-4-hydroxybenzenesulfonic acid
InChIKeyPGDCAFRJYQICAY-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)O)Cl)S(=O)(=O)O

Computed by PubChem (NCBI)