CAS 2532-18-5 is the registry number for 3-Iodobenzoate (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 3-iodobenzoate (CAS 2532-18-5) is a chemical compound with the molecular formula C7H4INaO2 and a molecular weight of 270.00 g/mol. IUPAC name: sodium 3-iodobenzoate. InChIKey: IVXHGRUGOBXOSX-UHFFFAOYSA-M.
| Molecular formula | C7H4INaO2 |
|---|---|
| Molecular weight | 270.00 g/mol |
| IUPAC name | sodium 3-iodobenzoate |
| InChIKey | IVXHGRUGOBXOSX-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)I)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)