CAS 253268-25-6 appears in our catalog under these names: 4,6-Dichloro-3-hydroxy-2-nitrobenzoic acid, 97%, 4,6-Dichloro-3-hydroxy-2-nitrobenzoic acid, 96%, 96%, 4,6-Dichloro-3-hydroxy-2-nitrobenzoic acid, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4,6-dichloro-3-hydroxy-2-nitrobenzoic acid (CAS 253268-25-6) is a chemical compound with the molecular formula C7H3Cl2NO5 and a molecular weight of 252.00 g/mol. IUPAC name: 4,6-dichloro-3-hydroxy-2-nitrobenzoic acid. InChIKey: WKTGFYBNDVOWML-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO5 |
|---|---|
| Molecular weight | 252.00 g/mol |
| IUPAC name | 4,6-dichloro-3-hydroxy-2-nitrobenzoic acid |
| InChIKey | WKTGFYBNDVOWML-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)O)[N+](=O)[O-])C(=O)O)Cl |
Computed by PubChem (NCBI)