CAS 25327-89-3 appears in our catalog under these names: 2,2',6,6'-Tetrabromobisphenol a diallyl ether, 98%, 5,5'-(Propane-2,2-diyl)bis(2-(allyloxy)-1,3-dibromobenzene), 99%, Tetrabromobisphenol A Allyl Ether, >95% (HPLC), Tetrabromobisphenol A-diallyl ether, 2,2–Bis(4–allyloxy–3,5–dibromophenyl)propane. Offered by: Combi-blocks, AmBeed, TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 5g, 25g, 100g, 1g, 10g, 500g, 100mg, 2.5kg.
1,3-dibromo-5-[2-(3,5-dibromo-4-prop-2-enoxyphenyl)propan-2-yl]-2-prop-2-enoxybenzene (CAS 25327-89-3) is a chemical compound with the molecular formula C21H20Br4O2 and a molecular weight of 624.0 g/mol. IUPAC name: 1,3-dibromo-5-[2-(3,5-dibromo-4-prop-2-enoxyphenyl)propan-2-yl]-2-prop-2-enoxybenzene. InChIKey: PWXTUWQHMIFLKL-UHFFFAOYSA-N.
| Molecular formula | C21H20Br4O2 |
|---|---|
| Molecular weight | 624.0 g/mol |
| IUPAC name | 1,3-dibromo-5-[2-(3,5-dibromo-4-prop-2-enoxyphenyl)propan-2-yl]-2-prop-2-enoxybenzene |
| InChIKey | PWXTUWQHMIFLKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C(=C1)Br)OCC=C)Br)C2=CC(=C(C(=C2)Br)OCC=C)Br |
Computed by PubChem (NCBI)