CAS 25332-44-9 is the registry number for Cycloguanil Nitrate. Offered by: TRC. Available pack sizes: 25mg.
1-(4-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine;nitric acid (CAS 25332-44-9) is a chemical compound with the molecular formula C11H15ClN6O3 and a molecular weight of 314.73 g/mol. IUPAC name: 1-(4-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine;nitric acid. InChIKey: AUXYPSRADKAKOK-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN6O3 |
|---|---|
| Molecular weight | 314.73 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine;nitric acid |
| InChIKey | AUXYPSRADKAKOK-UHFFFAOYSA-N |
| SMILES | CC1(N=C(N=C(N1C2=CC=C(C=C2)Cl)N)N)C.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)