Products 25342-82-9
CAS 25342-82-9 appears in our catalog under these names: Corydine Impurity 1, Menisperine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 25mg.
1,2,10-trimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-11-ol (CAS 25342-82-9) is a chemical compound with the molecular formula C21H26NO4+ and a molecular weight of 356.4 g/mol. IUPAC name: 1,2,10-trimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-11-ol. InChIKey: XQINTCORIZHGFD-UHFFFAOYSA-O.
| Molecular formula | C21H26NO4+ |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 1,2,10-trimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-11-ol |
| InChIKey | XQINTCORIZHGFD-UHFFFAOYSA-O |
| SMILES | C[N+]1(CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC)C |
Computed by PubChem (NCBI)