CAS 253446-15-0 appears in our catalog under these names: R(+)-SKF-81297 Hydrobromide, (R)-SKF-81297 (hydrobromide). Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 1mg, 2mg, 5mg, 5 mg, 1 mg.
(5R)-9-chloro-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide (CAS 253446-15-0) is a chemical compound with the molecular formula C16H17BrClNO2 and a molecular weight of 370.7 g/mol. IUPAC name: (5R)-9-chloro-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide. InChIKey: RMIJGBMRNYUZRG-BTQNPOSSSA-N.
| Molecular formula | C16H17BrClNO2 |
|---|---|
| Molecular weight | 370.7 g/mol |
| IUPAC name | (5R)-9-chloro-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide |
| InChIKey | RMIJGBMRNYUZRG-BTQNPOSSSA-N |
| SMILES | C1CNC[C@@H](C2=CC(=C(C(=C21)Cl)O)O)C3=CC=CC=C3.Br |
Computed by PubChem (NCBI)