Products 2535-06-0
CAS 2535-06-0 appears in our catalog under these names: 16–O–Acetylpolyporenic acid C, 16-O-Acetylpolyporenic acid C. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
2,3,6-trimethylbenzoic acid (CAS 2535-06-0) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: 2,3,6-trimethylbenzoic acid. InChIKey: JRUKSSBDIZXQDX-UHFFFAOYSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | 2,3,6-trimethylbenzoic acid |
| InChIKey | JRUKSSBDIZXQDX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C)C(=O)O)C |
Computed by PubChem (NCBI)