CAS 25357-31-7 is the registry number for cis-1-Methyl-4-cyclohexene-1,2-dicarboxylic Anhydride. Offered by: TRC. Available pack sizes: 250mg.
(3aS,7aR)-7a-methyl-4,7-dihydro-3aH-2-benzofuran-1,3-dione (CAS 25357-31-7) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 166.17 g/mol. IUPAC name: (3aS,7aR)-7a-methyl-4,7-dihydro-3aH-2-benzofuran-1,3-dione. InChIKey: SOOZEQGBHHIHEF-HZGVNTEJSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | (3aS,7aR)-7a-methyl-4,7-dihydro-3aH-2-benzofuran-1,3-dione |
| InChIKey | SOOZEQGBHHIHEF-HZGVNTEJSA-N |
| SMILES | C[C@@]12CC=CC[C@@H]1C(=O)OC2=O |
Computed by PubChem (NCBI)