Products 2536615-48-0
CAS 2536615-48-0 is the registry number for 4-[2-(9-Anthracenyl)ethynyl]benzenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(2-anthracen-9-ylethynyl)aniline (CAS 2536615-48-0) is a chemical compound with the molecular formula C22H15N and a molecular weight of 293.4 g/mol. IUPAC name: 4-(2-anthracen-9-ylethynyl)aniline. InChIKey: JFAVMQZTBAMYLL-UHFFFAOYSA-N.
| Molecular formula | C22H15N |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 4-(2-anthracen-9-ylethynyl)aniline |
| InChIKey | JFAVMQZTBAMYLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2C#CC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)