CAS 2951097-62-2 is the registry number for 3-(Pyren-1-yl)aniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-pyren-1-ylaniline (CAS 2951097-62-2) is a chemical compound with the molecular formula C22H15N and a molecular weight of 293.4 g/mol. IUPAC name: 3-pyren-1-ylaniline. InChIKey: AMLGUBYRDNTKBA-UHFFFAOYSA-N.
| Molecular formula | C22H15N |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 3-pyren-1-ylaniline |
| InChIKey | AMLGUBYRDNTKBA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C5=CC(=CC=C5)N |
Computed by PubChem (NCBI)