CAS 25372-42-3 appears in our catalog under these names: 1-(3-Fluorophenyl)imidazole, 95%, 1-(3-Fluorophenyl)imidazole, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
1-(3-fluorophenyl)imidazole (CAS 25372-42-3) is a chemical compound with the molecular formula C9H7FN2 and a molecular weight of 162.16 g/mol. IUPAC name: 1-(3-fluorophenyl)imidazole. InChIKey: SQJDRLQZCRNMQU-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2 |
|---|---|
| Molecular weight | 162.16 g/mol |
| IUPAC name | 1-(3-fluorophenyl)imidazole |
| InChIKey | SQJDRLQZCRNMQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2C=CN=C2 |
Computed by PubChem (NCBI)