CAS 25373-20-0 appears in our catalog under these names: 3,4–Dibromothiophene–2,5–dicarboxaldehyde, 3,4-Dibromothiophene-2,5-dicarboxaldehyde 95+%, 3,4-DIBROMOTHIOPHENE-2,5-DICARBOXALDEHY&, 3,4-DIBROMOTHIOPHENE-2,5-DICARBALDEHYDE, 95+%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,4-dibromothiophene-2,5-dicarbaldehyde (CAS 25373-20-0) is a chemical compound with the molecular formula C6H2Br2O2S and a molecular weight of 297.95 g/mol. IUPAC name: 3,4-dibromothiophene-2,5-dicarbaldehyde. InChIKey: UIIQKZFRHPLSLU-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2O2S |
|---|---|
| Molecular weight | 297.95 g/mol |
| IUPAC name | 3,4-dibromothiophene-2,5-dicarbaldehyde |
| InChIKey | UIIQKZFRHPLSLU-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(C(=C(S1)C=O)Br)Br |
Computed by PubChem (NCBI)