CAS 253788-12-4 is the registry number for 4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tris(benzene-1,2-diol), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4,6-bis(3,4-dihydroxyphenyl)-1,3,5-triazin-2-yl]benzene-1,2-diol (CAS 253788-12-4) is a chemical compound with the molecular formula C21H15N3O6 and a molecular weight of 405.4 g/mol. IUPAC name: 4-[4,6-bis(3,4-dihydroxyphenyl)-1,3,5-triazin-2-yl]benzene-1,2-diol. InChIKey: FPQDYHIZOGFSFQ-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O6 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | 4-[4,6-bis(3,4-dihydroxyphenyl)-1,3,5-triazin-2-yl]benzene-1,2-diol |
| InChIKey | FPQDYHIZOGFSFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC(=NC(=N2)C3=CC(=C(C=C3)O)O)C4=CC(=C(C=C4)O)O)O)O |
Computed by PubChem (NCBI)