CAS 25380-80-7 is the registry number for 4-Chloro-1,2-benzisothiazol-3-amine. Offered by: TRC. Available pack sizes: 1g.
4-chloro-1,2-benzothiazol-3-amine (CAS 25380-80-7) is a chemical compound with the molecular formula C7H5ClN2S and a molecular weight of 184.65 g/mol. IUPAC name: 4-chloro-1,2-benzothiazol-3-amine. InChIKey: ADWGJRRSHRRTLE-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2S |
|---|---|
| Molecular weight | 184.65 g/mol |
| IUPAC name | 4-chloro-1,2-benzothiazol-3-amine |
| InChIKey | ADWGJRRSHRRTLE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=NS2)N |
Computed by PubChem (NCBI)