CAS 25383-48-6 is the registry number for Di-tert-butyl Allenylphosphonate. Offered by: TRC. Available pack sizes: 5g.
2-methyl-2-[(2-methylpropan-2-yl)oxy-propa-1,2-dienylphosphoryl]oxypropane (CAS 25383-48-6) is a chemical compound with the molecular formula C11H21O3P and a molecular weight of 232.26 g/mol. IUPAC name: 2-methyl-2-[(2-methylpropan-2-yl)oxy-propa-1,2-dienylphosphoryl]oxypropane. InChIKey: NZXLRRWVIZTRAU-UHFFFAOYSA-N.
| Molecular formula | C11H21O3P |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 2-methyl-2-[(2-methylpropan-2-yl)oxy-propa-1,2-dienylphosphoryl]oxypropane |
| InChIKey | NZXLRRWVIZTRAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OP(=O)(C=C=C)OC(C)(C)C |
Computed by PubChem (NCBI)