CAS 25393-98-0 appears in our catalog under these names: 1,4-Bis(1,2-dibromoethyl)benzene, 95%, 1,4-Bis(1,2-dibromoethyl)benzene, 97%, 1,4–Bis(1,2–dibromoethyl)benzene, 1,4-Bis(1,2-dibromoethyl)benzene. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
1,4-bis(1,2-dibromoethyl)benzene (CAS 25393-98-0) is a chemical compound with the molecular formula C10H10Br4 and a molecular weight of 449.80 g/mol. IUPAC name: 1,4-bis(1,2-dibromoethyl)benzene. InChIKey: KDBQQANTDCVPDZ-UHFFFAOYSA-N.
| Molecular formula | C10H10Br4 |
|---|---|
| Molecular weight | 449.80 g/mol |
| IUPAC name | 1,4-bis(1,2-dibromoethyl)benzene |
| InChIKey | KDBQQANTDCVPDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CBr)Br)C(CBr)Br |
Computed by PubChem (NCBI)