CAS 2540881-21-6 appears in our catalog under these names: 3-(3-Hydroxyphenyl)-1-methyl-7-((3-(4-methylpiperazin-1-yl)phenyl)amino)-1,6-naphthyridin-2(1H)-one, 95%, UH15-38, 99.80%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: 5mg, 1mg, 100 mg, 50 mg, 5 mg, 25 mg, 10 mg, 10mM/1mL.
3-(3-hydroxyphenyl)-1-methyl-7-[3-(4-methylpiperazin-1-yl)anilino]-1,6-naphthyridin-2-one (CAS 2540881-21-6) is a chemical compound with the molecular formula C26H27N5O2 and a molecular weight of 441.5 g/mol. IUPAC name: 3-(3-hydroxyphenyl)-1-methyl-7-[3-(4-methylpiperazin-1-yl)anilino]-1,6-naphthyridin-2-one. InChIKey: DLRROFRAOBFFEP-UHFFFAOYSA-N.
| Molecular formula | C26H27N5O2 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | 3-(3-hydroxyphenyl)-1-methyl-7-[3-(4-methylpiperazin-1-yl)anilino]-1,6-naphthyridin-2-one |
| InChIKey | DLRROFRAOBFFEP-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=CC(=C2)NC3=NC=C4C=C(C(=O)N(C4=C3)C)C5=CC(=CC=C5)O |
Computed by PubChem (NCBI)