CAS 2541792-70-3 appears in our catalog under these names: ASK1-IN-2, 98%, ASK1–IN–2, ASK1-IN-2/ 99.36% (existing batch purity), ASK1-IN-2, ASK1-IN-2 98%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 10mM (in 1ml dmso), 1mg, 50mg, 100mg, 250mg.
6-fluoro-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]-1H-indole-2-carboxamide (CAS 2541792-70-3) is a chemical compound with the molecular formula C19H17FN6O and a molecular weight of 364.4 g/mol. IUPAC name: 6-fluoro-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]-1H-indole-2-carboxamide. InChIKey: LYUQNMNUBOUCBX-UHFFFAOYSA-N.
| Molecular formula | C19H17FN6O |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 6-fluoro-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]-1H-indole-2-carboxamide |
| InChIKey | LYUQNMNUBOUCBX-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NN=C1C2=NC(=CC=C2)NC(=O)C3=CC4=C(N3)C=C(C=C4)F |
Computed by PubChem (NCBI)