CAS 2542181-73-5 is the registry number for Potassium trifluoro(6-oxaspiro(2.5)octan-1-yl)borate, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg, 1g.
Potassium trifluoro(6-oxaspiro[2.5]octan-2-yl)boranuide (CAS 2542181-73-5) is a chemical compound with the molecular formula C7H11BF3KO and a molecular weight of 218.07 g/mol. IUPAC name: potassium trifluoro(6-oxaspiro[2.5]octan-2-yl)boranuide. InChIKey: GGQQJYHSYQPQGB-UHFFFAOYSA-N.
| Molecular formula | C7H11BF3KO |
|---|---|
| Molecular weight | 218.07 g/mol |
| IUPAC name | potassium trifluoro(6-oxaspiro[2.5]octan-2-yl)boranuide |
| InChIKey | GGQQJYHSYQPQGB-UHFFFAOYSA-N |
| SMILES | [B-](C1CC12CCOCC2)(F)(F)F.[K+] |
Computed by PubChem (NCBI)