CAS 25431-45-2 is the registry number for 1H,1H,2H-Perfluorononene-1, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoronon-1-ene (CAS 25431-45-2) is a chemical compound with the molecular formula C9H3F15 and a molecular weight of 396.10 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoronon-1-ene. InChIKey: RXZWAMINHJDYKW-UHFFFAOYSA-N.
| Molecular formula | C9H3F15 |
|---|---|
| Molecular weight | 396.10 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoronon-1-ene |
| InChIKey | RXZWAMINHJDYKW-UHFFFAOYSA-N |
| SMILES | C=CC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)