CAS 25444-82-0 appears in our catalog under these names: 1-Adamantylthiourea, 95%, 1–Adamantylthiourea, 1-Adamantylthiourea 95+%, 1-(Adamantan-1-yl)thiourea, 98%, 98%, 1-Adamantylthiourea. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 10g, 5g, 250mg, 1 g, 250 mg.
1-adamantylthiourea (CAS 25444-82-0) is a chemical compound with the molecular formula C11H18N2S and a molecular weight of 210.34 g/mol. IUPAC name: 1-adamantylthiourea. InChIKey: LRWQENBAFMBIJR-UHFFFAOYSA-N.
| Molecular formula | C11H18N2S |
|---|---|
| Molecular weight | 210.34 g/mol |
| IUPAC name | 1-adamantylthiourea |
| InChIKey | LRWQENBAFMBIJR-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)NC(=S)N |
Computed by PubChem (NCBI)