CAS 25465-65-0 is the registry number for (-)-Isopinocampheol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 25g.
(1S,2S,3R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol (CAS 25465-65-0) is a chemical compound with the molecular formula C10H18O and a molecular weight of 154.25 g/mol. IUPAC name: (1S,2S,3R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol. InChIKey: REPVLJRCJUVQFA-UYXSQOIJSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 154.25 g/mol |
| IUPAC name | (1S,2S,3R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol |
| InChIKey | REPVLJRCJUVQFA-UYXSQOIJSA-N |
| SMILES | C[C@H]1[C@@H]2C[C@@H](C2(C)C)C[C@H]1O |
Computed by PubChem (NCBI)