CAS 254884-18-9 appears in our catalog under these names: Erdosteine Thioacid Disodium Salt, Erdosteine Thioacid Disodium Salt, >95% (HPLC), Erdosteine Thioacid Disodium Salt, 95%, 95%. Offered by: Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: on request, 100mg, 250mg, 50mg, 10mg, 25mg.
Disodium;2-[[2-(carboxylatomethylsulfanyl)acetyl]amino]-4-sulfanylbutanoate (CAS 254884-18-9) is a chemical compound with the molecular formula C8H11NNa2O5S2 and a molecular weight of 311.3 g/mol. IUPAC name: disodium;2-[[2-(carboxylatomethylsulfanyl)acetyl]amino]-4-sulfanylbutanoate. InChIKey: MYYRYICRQPFZPU-UHFFFAOYSA-L.
| Molecular formula | C8H11NNa2O5S2 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | disodium;2-[[2-(carboxylatomethylsulfanyl)acetyl]amino]-4-sulfanylbutanoate |
| InChIKey | MYYRYICRQPFZPU-UHFFFAOYSA-L |
| SMILES | C(CS)C(C(=O)[O-])NC(=O)CSCC(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)