CAS 254886-77-6 appears in our catalog under these names: Kushenol X, Kushenol X, ≥95%, ≥95%, Kushenol X, 97.0%. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 1 mg.
(2R,3R)-2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)-2,3-dihydrochromen-4-one (CAS 254886-77-6) is a chemical compound with the molecular formula C25H28O7 and a molecular weight of 440.5 g/mol. IUPAC name: (2R,3R)-2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)-2,3-dihydrochromen-4-one. InChIKey: ZJRPDIPXWGIHRB-SBCNVUAESA-N.
| Molecular formula | C25H28O7 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | (2R,3R)-2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)-2,3-dihydrochromen-4-one |
| InChIKey | ZJRPDIPXWGIHRB-SBCNVUAESA-N |
| SMILES | CC(=CCC(CC1=C2C(=C(C=C1O)O)C(=O)[C@@H]([C@H](O2)C3=C(C=C(C=C3)O)O)O)C(=C)C)C |
Computed by PubChem (NCBI)