CAS 254887-18-8 appears in our catalog under these names: 4-Bromo-1-(bromomethyl)-2-(methylsulfonyl)benzene, 95%, 4-Bromo-1-(bromomethyl)-2-(methylsulfonyl)benzene. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g.
4-bromo-1-(bromomethyl)-2-methylsulfonylbenzene (CAS 254887-18-8) is a chemical compound with the molecular formula C8H8Br2O2S and a molecular weight of 328.02 g/mol. IUPAC name: 4-bromo-1-(bromomethyl)-2-methylsulfonylbenzene. InChIKey: PJFOHHNHJUOESV-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2O2S |
|---|---|
| Molecular weight | 328.02 g/mol |
| IUPAC name | 4-bromo-1-(bromomethyl)-2-methylsulfonylbenzene |
| InChIKey | PJFOHHNHJUOESV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)Br)CBr |
Computed by PubChem (NCBI)