CAS 254888-04-5 is the registry number for 3-(tert-butyl)-2-(4-nitrophenyl)-6-nitroindeno(3,2-c)pyrazol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-tert-butyl-6-nitro-2-(4-nitrophenyl)indeno[1,2-c]pyrazol-4-one (CAS 254888-04-5) is a chemical compound with the molecular formula C20H16N4O5 and a molecular weight of 392.4 g/mol. IUPAC name: 3-tert-butyl-6-nitro-2-(4-nitrophenyl)indeno[1,2-c]pyrazol-4-one. InChIKey: RXTGVVMQIVKLCP-UHFFFAOYSA-N.
| Molecular formula | C20H16N4O5 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 3-tert-butyl-6-nitro-2-(4-nitrophenyl)indeno[1,2-c]pyrazol-4-one |
| InChIKey | RXTGVVMQIVKLCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C2C(=NN1C3=CC=C(C=C3)[N+](=O)[O-])C4=C(C2=O)C=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)