Products 2549186-99-2
CAS 2549186-99-2 is the registry number for 5-Bromo-2-((tert-butyldimethylsilyl)ethynyl)-4-methylpyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-bromo-4-methyl-2-pyridinyl)ethynyl-tert-butyl-dimethylsilane (CAS 2549186-99-2) is a chemical compound with the molecular formula C14H20BrNSi and a molecular weight of 310.30 g/mol. IUPAC name: 2-(5-bromo-4-methyl-2-pyridinyl)ethynyl-tert-butyl-dimethylsilane. InChIKey: AFMMZBYKZUSBSM-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNSi |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | 2-(5-bromo-4-methyl-2-pyridinyl)ethynyl-tert-butyl-dimethylsilane |
| InChIKey | AFMMZBYKZUSBSM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1Br)C#C[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)