CAS 25501-08-0 appears in our catalog under these names: 1-((2R,4R,5R)-4-Hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1,3,5-triazine-2,4(1H,3H)-dione, 98%, Decitabine Impurity 43 (5-Aza-2’-deoxyuridine), 5-Aza-2’-deoxyuridine (Beta Isomer Only), 5-Aza-2’-deoxyuridine (β isomer only). Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 2mg.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazine-2,4-dione (CAS 25501-08-0) is a chemical compound with the molecular formula C8H11N3O5 and a molecular weight of 229.19 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazine-2,4-dione. InChIKey: QVHBBRWEQLPGLD-KVQBGUIXSA-N.
| Molecular formula | C8H11N3O5 |
|---|---|
| Molecular weight | 229.19 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazine-2,4-dione |
| InChIKey | QVHBBRWEQLPGLD-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC(=O)NC2=O)CO)O |
Computed by PubChem (NCBI)