Products 2550397-96-9
CAS 2550397-96-9 is the registry number for p38α inhibitor 5, 98.69%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 25 mg, 10 mg, 50 mg.
3-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]-4-methyl-N-pent-4-ynylbenzamide (CAS 2550397-96-9) is a chemical compound with the molecular formula C26H23BrF2N2O3 and a molecular weight of 529.4 g/mol. IUPAC name: 3-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]-4-methyl-N-pent-4-ynylbenzamide. InChIKey: QLEBSHDRQODERX-UHFFFAOYSA-N.
| Molecular formula | C26H23BrF2N2O3 |
|---|---|
| Molecular weight | 529.4 g/mol |
| IUPAC name | 3-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]-4-methyl-N-pent-4-ynylbenzamide |
| InChIKey | QLEBSHDRQODERX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NCCCC#C)N2C(=CC(=C(C2=O)Br)OCC3=C(C=C(C=C3)F)F)C |
Computed by PubChem (NCBI)
Synonyms:
p38|A inhibitor 5, orb2814309