CAS 2553357-10-9 is the registry number for 5-(2-Methylpyrimidin-5-yl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-methylpyrimidin-5-yl)-1,3,4-thiadiazol-2-amine (CAS 2553357-10-9) is a chemical compound with the molecular formula C7H7N5S and a molecular weight of 193.23 g/mol. IUPAC name: 5-(2-methylpyrimidin-5-yl)-1,3,4-thiadiazol-2-amine. InChIKey: KRZBIXWGWFDAGE-UHFFFAOYSA-N.
| Molecular formula | C7H7N5S |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 5-(2-methylpyrimidin-5-yl)-1,3,4-thiadiazol-2-amine |
| InChIKey | KRZBIXWGWFDAGE-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=N1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)