Products 2555249-90-4

CAS 2555249-90-4 is the registry number for Methyl 4-(piperazin-2-yl)benzoate diacetate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Acetic acid;methyl 4-piperazin-2-ylbenzoate (CAS 2555249-90-4) is a chemical compound with the molecular formula C16H24N2O6 and a molecular weight of 340.37 g/mol. IUPAC name: acetic acid;methyl 4-piperazin-2-ylbenzoate. InChIKey: ZQYWNGDCNNLWCV-UHFFFAOYSA-N.

Identity
Molecular formulaC16H24N2O6
Molecular weight340.37 g/mol
IUPAC nameacetic acid;methyl 4-piperazin-2-ylbenzoate
InChIKeyZQYWNGDCNNLWCV-UHFFFAOYSA-N
SMILESCC(=O)O.CC(=O)O.COC(=O)C1=CC=C(C=C1)C2CNCCN2

Computed by PubChem (NCBI)