Products 224624-80-0
CAS 224624-80-0 appears in our catalog under these names: Miridesap, Miridesap/ 98%, CPHPC, CPHPC(Miridesap) 97%, Miridesap, 97%, 97%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 2,5g, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
(2R)-1-[6-[(2R)-2-carboxypyrrolidin-1-yl]-6-oxohexanoyl]pyrrolidine-2-carboxylic acid (CAS 224624-80-0) is a chemical compound with the molecular formula C16H24N2O6 and a molecular weight of 340.37 g/mol. IUPAC name: (2R)-1-[6-[(2R)-2-carboxypyrrolidin-1-yl]-6-oxohexanoyl]pyrrolidine-2-carboxylic acid. InChIKey: HZLAWYIBLZNRFZ-VXGBXAGGSA-N.
| Molecular formula | C16H24N2O6 |
|---|---|
| Molecular weight | 340.37 g/mol |
| IUPAC name | (2R)-1-[6-[(2R)-2-carboxypyrrolidin-1-yl]-6-oxohexanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | HZLAWYIBLZNRFZ-VXGBXAGGSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)CCCCC(=O)N2CCC[C@@H]2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)