CAS 25565-82-6 is the registry number for 3-(4-Aminobutyl)-1,3-thiazolidine-2,4-dione hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(4-aminobutyl)-1,3-thiazolidine-2,4-dione;hydrochloride (CAS 25565-82-6) is a chemical compound with the molecular formula C7H13ClN2O2S and a molecular weight of 224.71 g/mol. IUPAC name: 3-(4-aminobutyl)-1,3-thiazolidine-2,4-dione;hydrochloride. InChIKey: WFZSXPQAZGJHFI-UHFFFAOYSA-N.
| Molecular formula | C7H13ClN2O2S |
|---|---|
| Molecular weight | 224.71 g/mol |
| IUPAC name | 3-(4-aminobutyl)-1,3-thiazolidine-2,4-dione;hydrochloride |
| InChIKey | WFZSXPQAZGJHFI-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)S1)CCCCN.Cl |
Computed by PubChem (NCBI)