CAS 2557-81-5 appears in our catalog under these names: Phenylsulfur pentafluoride, 95%, Phenylsulfur Pentafluoride, Phenylsulfurpentafluoride 98%, Phenylsulfurpentafluoride, 98%, 98%, Phenylsulfur pentafluoride, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.
Pentafluoro(phenyl)-lambda6-sulfane (CAS 2557-81-5) is a chemical compound with the molecular formula C6H5F5S and a molecular weight of 204.16 g/mol. IUPAC name: pentafluoro(phenyl)-lambda6-sulfane. InChIKey: DMNYFEWFSFTYEL-UHFFFAOYSA-N.
| Molecular formula | C6H5F5S |
|---|---|
| Molecular weight | 204.16 g/mol |
| IUPAC name | pentafluoro(phenyl)-lambda6-sulfane |
| InChIKey | DMNYFEWFSFTYEL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)