Products 2557349-50-3
CAS 2557349-50-3 is the registry number for NP3-253, 99.78%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 10mM/1mL, 5 mg, 50 mg.
2-[6-[[(3R)-1-ethylpiperidin-3-yl]amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol (CAS 2557349-50-3) is a chemical compound with the molecular formula C19H23F3N4O and a molecular weight of 380.4 g/mol. IUPAC name: 2-[6-[[(3R)-1-ethylpiperidin-3-yl]amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol. InChIKey: UVVZGYXCKGWWCC-CQSZACIVSA-N.
| Molecular formula | C19H23F3N4O |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 2-[6-[[(3R)-1-ethylpiperidin-3-yl]amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol |
| InChIKey | UVVZGYXCKGWWCC-CQSZACIVSA-N |
| SMILES | CCN1CCC[C@H](C1)NC2=NN=C(C=C2)C3=C(C=C(C=C3C)C(F)(F)F)O |
Computed by PubChem (NCBI)