Products 25580-88-5

CAS 25580-88-5 is the registry number for 6-(6-(Carboxyamino)hexanamido)-hexanoic Acid N-Benzyl Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.

Structural formula: {0} (CAS {1})

Methyl 6-[6-(phenylmethoxycarbonylamino)hexanoylamino]hexanoate (CAS 25580-88-5) is a chemical compound with the molecular formula C21H32N2O5 and a molecular weight of 392.5 g/mol. IUPAC name: methyl 6-[6-(phenylmethoxycarbonylamino)hexanoylamino]hexanoate. InChIKey: LBPIUWSSHRKAJU-UHFFFAOYSA-N.

Identity
Molecular formulaC21H32N2O5
Molecular weight392.5 g/mol
IUPAC namemethyl 6-[6-(phenylmethoxycarbonylamino)hexanoylamino]hexanoate
InChIKeyLBPIUWSSHRKAJU-UHFFFAOYSA-N
SMILESCOC(=O)CCCCCNC(=O)CCCCCNC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)