CAS 255818-98-5 appears in our catalog under these names: Beta-D-thioglucose sodium salt hydrate, 96%, b-D-Thioglucose sodium salt hydrate, Beta-D-thioglucose sodium salt hydrate, 96%, 96%. Offered by: Combi-blocks, Biosynth, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 0,1g, 0,05g, 0,25g, 0,5g, 50mg, 100mg.
Sodium;(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-thiolate;hydrate (CAS 255818-98-5) is a chemical compound with the molecular formula C6H13NaO6S and a molecular weight of 236.22 g/mol. IUPAC name: sodium;(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-thiolate;hydrate. InChIKey: FOVTYEYRNBRYMM-UZUGEDCSSA-M.
| Molecular formula | C6H13NaO6S |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | sodium;(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-thiolate;hydrate |
| InChIKey | FOVTYEYRNBRYMM-UZUGEDCSSA-M |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)[S-])O)O)O)O.O.[Na+] |
Computed by PubChem (NCBI)