Products 2558205-28-8
CAS 2558205-28-8 appears in our catalog under these names: AkaLumine hydrochloride/ 96.72% (existing batch purity), AkaLumine hydrochloride, AkaLumine hydrochloride, ≥98%, ≥98%, AkaLumine (hydrochloride), 99.92%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 50 mg, 5 mg.
(4S)-2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid;hydrochloride (CAS 2558205-28-8) is a chemical compound with the molecular formula C16H19ClN2O2S and a molecular weight of 338.9 g/mol. IUPAC name: (4S)-2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid;hydrochloride. InChIKey: PZCNKVAGZCXXHX-SSRSOBHISA-N.
| Molecular formula | C16H19ClN2O2S |
|---|---|
| Molecular weight | 338.9 g/mol |
| IUPAC name | (4S)-2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid;hydrochloride |
| InChIKey | PZCNKVAGZCXXHX-SSRSOBHISA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C=C/C2=N[C@H](CS2)C(=O)O.Cl |
Computed by PubChem (NCBI)