CAS 255836-67-0 appears in our catalog under these names: Rac-2-(di-t-butylphosphino)-1,1'-binaphthyl, 98%, 2-(Di-tert-butylphosphino)-1,1'-binaphthyl 98% TrixiePhos, TrixiePhos 98%, TRIXIEPHOS, 97%, [1,1'-Binaphthalen]-2-yldi-tert-butylphosphine, 98%, 98%. Offered by: Combi-blocks, TRC, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g, 10g, 25g, 100g.
Ditert-butyl-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane (CAS 255836-67-0) is a chemical compound with the molecular formula C28H31P and a molecular weight of 398.5 g/mol. IUPAC name: ditert-butyl-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane. InChIKey: QGBQGMHXBSLYLZ-UHFFFAOYSA-N.
| Molecular formula | C28H31P |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | ditert-butyl-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane |
| InChIKey | QGBQGMHXBSLYLZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(C1=C(C2=CC=CC=C2C=C1)C3=CC=CC4=CC=CC=C43)C(C)(C)C |
Computed by PubChem (NCBI)