CAS 25612-46-8 appears in our catalog under these names: (2S,2'S)-6,6'-Azanediylbis(2-aminohexanoic acid), 98%, Lysino Norleucine, >95% (HPLC), LNL, Lysinonorleucine, Lysino norleucine TFA salt. Offered by: Chemat Brand, TRC, Iris Biotech, MedChemExpress, Biosynth. Available pack sizes: on request, 1mg, 2,5mg, 5mg, 10mg, 2.5 mg, 1 mg, 5 mg.
(2S)-2-amino-6-[[(5S)-5-amino-5-carboxypentyl]amino]hexanoic acid (CAS 25612-46-8) is a chemical compound with the molecular formula C12H25N3O4 and a molecular weight of 275.34 g/mol. IUPAC name: (2S)-2-amino-6-[[(5S)-5-amino-5-carboxypentyl]amino]hexanoic acid. InChIKey: HYLBTMZBXLEVCL-UWVGGRQHSA-N.
| Molecular formula | C12H25N3O4 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | (2S)-2-amino-6-[[(5S)-5-amino-5-carboxypentyl]amino]hexanoic acid |
| InChIKey | HYLBTMZBXLEVCL-UWVGGRQHSA-N |
| SMILES | C(CCNCCCC[C@@H](C(=O)O)N)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)