Products 2561478-74-6

CAS 2561478-74-6 is the registry number for (3S,4S)-3-Amino-4-chlorocyclopent-1-ene-1-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3S,4S)-3-amino-4-chlorocyclopentene-1-carboxylic acid;hydrochloride (CAS 2561478-74-6) is a chemical compound with the molecular formula C6H9Cl2NO2 and a molecular weight of 198.04 g/mol. IUPAC name: (3S,4S)-3-amino-4-chlorocyclopentene-1-carboxylic acid;hydrochloride. InChIKey: JEVWRTKEJJHWTA-FHAQVOQBSA-N.

Identity
Molecular formulaC6H9Cl2NO2
Molecular weight198.04 g/mol
IUPAC name(3S,4S)-3-amino-4-chlorocyclopentene-1-carboxylic acid;hydrochloride
InChIKeyJEVWRTKEJJHWTA-FHAQVOQBSA-N
SMILESC1[C@@H]([C@H](C=C1C(=O)O)N)Cl.Cl

Computed by PubChem (NCBI)