CAS 2561478-74-6 is the registry number for (3S,4S)-3-Amino-4-chlorocyclopent-1-ene-1-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4S)-3-amino-4-chlorocyclopentene-1-carboxylic acid;hydrochloride (CAS 2561478-74-6) is a chemical compound with the molecular formula C6H9Cl2NO2 and a molecular weight of 198.04 g/mol. IUPAC name: (3S,4S)-3-amino-4-chlorocyclopentene-1-carboxylic acid;hydrochloride. InChIKey: JEVWRTKEJJHWTA-FHAQVOQBSA-N.
| Molecular formula | C6H9Cl2NO2 |
|---|---|
| Molecular weight | 198.04 g/mol |
| IUPAC name | (3S,4S)-3-amino-4-chlorocyclopentene-1-carboxylic acid;hydrochloride |
| InChIKey | JEVWRTKEJJHWTA-FHAQVOQBSA-N |
| SMILES | C1[C@@H]([C@H](C=C1C(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)