CAS 25617-45-2 is the registry number for 3-pyridyl-N-(4-trifluoromethyl)phenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-(trifluoromethyl)phenyl]pyridine-3-carboxamide (CAS 25617-45-2) is a chemical compound with the molecular formula C13H9F3N2O and a molecular weight of 266.22 g/mol. IUPAC name: N-[4-(trifluoromethyl)phenyl]pyridine-3-carboxamide. InChIKey: MPAHMZGMAHNWPG-UHFFFAOYSA-N.
| Molecular formula | C13H9F3N2O |
|---|---|
| Molecular weight | 266.22 g/mol |
| IUPAC name | N-[4-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| InChIKey | MPAHMZGMAHNWPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)NC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)