CAS 2562359-80-0 is the registry number for (4-(Dimethylamino)phenyl)diphenyl(propyl)phosphonium bromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[4-(dimethylamino)phenyl]-diphenyl-propylphosphanium bromide (CAS 2562359-80-0) is a chemical compound with the molecular formula C23H27BrNP and a molecular weight of 428.3 g/mol. IUPAC name: [4-(dimethylamino)phenyl]-diphenyl-propylphosphanium bromide. InChIKey: RYTAALOUUBQTST-UHFFFAOYSA-M.
| Molecular formula | C23H27BrNP |
|---|---|
| Molecular weight | 428.3 g/mol |
| IUPAC name | [4-(dimethylamino)phenyl]-diphenyl-propylphosphanium bromide |
| InChIKey | RYTAALOUUBQTST-UHFFFAOYSA-M |
| SMILES | CCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=C(C=C3)N(C)C.[Br-] |
Computed by PubChem (NCBI)