Products 2563598-63-8
CAS 2563598-63-8 is the registry number for 5-Amino-4-methyl-2,3-dihydro-1H-inden-1-one hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride (CAS 2563598-63-8) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride. InChIKey: XVTWXLMPKYHJTM-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 5-amino-4-methyl-2,3-dihydroinden-1-one;hydrochloride |
| InChIKey | XVTWXLMPKYHJTM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1CCC2=O)N.Cl |
Computed by PubChem (NCBI)