CAS 25637-99-4 appears in our catalog under these names: Hexabromocyclododecane, Hexabromocyclododecane (Mixture of Diastereomers). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g, 1g, 5g.
1,3,5,7,9,11-hexabromocyclododecane (CAS 25637-99-4) is a chemical compound with the molecular formula C12H18Br6 and a molecular weight of 641.7 g/mol. IUPAC name: 1,3,5,7,9,11-hexabromocyclododecane. InChIKey: LEOCKULGXOQRTQ-UHFFFAOYSA-N.
| Molecular formula | C12H18Br6 |
|---|---|
| Molecular weight | 641.7 g/mol |
| IUPAC name | 1,3,5,7,9,11-hexabromocyclododecane |
| InChIKey | LEOCKULGXOQRTQ-UHFFFAOYSA-N |
| SMILES | C1C(CC(CC(CC(CC(CC1Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)