Products 2563879-93-4
CAS 2563879-93-4 is the registry number for Antitumor agent-110. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-prop-2-ynyl-8-(1,3-thiazol-2-yl)imidazo[5,1-d][1,2,3,5]tetrazin-4-one (CAS 2563879-93-4) is a chemical compound with the molecular formula C10H6N6OS and a molecular weight of 258.26 g/mol. IUPAC name: 3-prop-2-ynyl-8-(1,3-thiazol-2-yl)imidazo[5,1-d][1,2,3,5]tetrazin-4-one. InChIKey: SDRJGLKNGWVTJR-UHFFFAOYSA-N.
| Molecular formula | C10H6N6OS |
|---|---|
| Molecular weight | 258.26 g/mol |
| IUPAC name | 3-prop-2-ynyl-8-(1,3-thiazol-2-yl)imidazo[5,1-d][1,2,3,5]tetrazin-4-one |
| InChIKey | SDRJGLKNGWVTJR-UHFFFAOYSA-N |
| SMILES | C#CCN1C(=O)N2C=NC(=C2N=N1)C3=NC=CS3 |
Computed by PubChem (NCBI)
Synonyms:
Antitumor agent-110, orb1944254